C37H69N7O7 — CID 155228524
(2S,5S,8S,11S,14S,17R,18R)-5-(4-aminobutoxymethyl)-8-(aminomethyl)-11-cycloheptyl-18-hexyl-2,15,17-trimethyl-14-propyl-1-oxa-3,6,9,12,15-pentazacyclooctadecane-4,7,10,13,16-pentone (PubChem CID 155228524) has the molecular formula C37H69N7O7 and a molecular weight of 724.00 g/mol. Its IUPAC name is (2S,5S,8S,11S,14S,17R,18R)-5-(4-aminobutoxymethyl)-8-(aminomethyl)-11-cycloheptyl-18-hexyl-2,15,17-trimethyl-14-propyl-1-oxa-3,6,9,12,15-pentazacyclooctadecane-4,7,10,13,16-pentone.
| Compound Name | (2S,5S,8S,11S,14S,17R,18R)-5-(4-aminobutoxymethyl)-8-(aminomethyl)-11-cycloheptyl-18-hexyl-2,15,17-trimethyl-14-propyl-1-oxa-3,6,9,12,15-pentazacyclooctadecane-4,7,10,13,16-pentone |
|---|---|
| PubChem CID | 155228524 |
| Molecular Formula | C37H69N7O7 |
| Molecular Weight | 724.00 g/mol |
| Exact Mass | 723.53 |
| IUPAC Name | (2S,5S,8S,11S,14S,17R,18R)-5-(4-aminobutoxymethyl)-8-(aminomethyl)-11-cycloheptyl-18-hexyl-2,15,17-trimethyl-14-propyl-1-oxa-3,6,9,12,15-pentazacyclooctadecane-4,7,10,13,16-pentone |
| SMILES | CCCCCC[C@H]1O[C@@H](C)NC(=O)[C@H](COCCCCN)NC(=O)[C@H](CN)NC(=O)[C@H](C2CCCCCC2)NC(=O)[C@H](CCC)N(C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C37H69N7O7/c1-6-8-9-14-20-31-25(3)37(49)44(5)30(17-7-2)35(47)43-32(27-18-12-10-11-13-19-27)36(48)41-28(23-39)33(45)42-29(24-50-22-16-15-21-38)34(46)40-26(4)51-31/h25-32H,6-24,38-39H2,1-5H3,(H,40,46)(H,41,48)(H,42,45)(H,43,47)/t25-,26+,28+,29+,30+,31-,32+/m1/s1 |
| InChIKey | MRYIJHCQCDWBBJ-WXNOHANISA-N |
| XLogP | 2.22 |
| TPSA | 207.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.00 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|