C21H27FN7O6P — CID 155228762
(2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanal (PubChem CID 155228762) has the molecular formula C21H27FN7O6P and a molecular weight of 523.46 g/mol. Its IUPAC name is (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanal.
| Compound Name | (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanal |
|---|---|
| PubChem CID | 155228762 |
| Molecular Formula | C21H27FN7O6P |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanal |
| SMILES | CNc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C=O)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C21H27FN7O6P/c1-12(9-30)28-36(32,35-13-7-5-4-6-8-13)33-10-14-16(31)21(2,22)19(34-14)29-11-25-15-17(24-3)26-20(23)27-18(15)29/h4-9,11-12,14,16,19,31H,10H2,1-3H3,(H,28,32)(H3,23,24,26,27)/t12-,14+,16+,19+,21+,36?/m0/s1 |
| InChIKey | KVJNJTDIUJLUCB-AIYQVQAHSA-N |
| XLogP | 1.82 |
| TPSA | 175.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|