C33H36O4 — CID 155228879
2-[[(3Z,5E)-5-[2,3-bis(ethenyl)-1-[(1E,3E)-1-ethenyl-4-(oxiran-2-ylmethoxy)penta-1,3-dienyl]inden-1-yl]hepta-1,3,5-trien-2-yl]oxymethyl]oxirane (PubChem CID 155228879) has the molecular formula C33H36O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[[(3Z,5E)-5-[2,3-bis(ethenyl)-1-[(1E,3E)-1-ethenyl-4-(oxiran-2-ylmethoxy)penta-1,3-dienyl]inden-1-yl]hepta-1,3,5-trien-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[(3Z,5E)-5-[2,3-bis(ethenyl)-1-[(1E,3E)-1-ethenyl-4-(oxiran-2-ylmethoxy)penta-1,3-dienyl]inden-1-yl]hepta-1,3,5-trien-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 155228879 |
| Molecular Formula | C33H36O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 2-[[(3Z,5E)-5-[2,3-bis(ethenyl)-1-[(1E,3E)-1-ethenyl-4-(oxiran-2-ylmethoxy)penta-1,3-dienyl]inden-1-yl]hepta-1,3,5-trien-2-yl]oxymethyl]oxirane |
| SMILES | C=CC1=C(C=C)C(/C(C=C)=C/C=C(\C)OCC2CO2)(C(/C=C\C(=C)OCC2CO2)=C/C)c2ccccc21 |
| InChI | InChI=1S/C33H36O4/c1-7-25(17-15-23(5)34-19-27-21-36-27)33(26(8-2)18-16-24(6)35-20-28-22-37-28)31(10-4)29(9-3)30-13-11-12-14-32(30)33/h7-18,27-28H,1,3-4,6,19-22H2,2,5H3/b18-16-,23-15+,25-17+,26-8+ |
| InChIKey | CBUVMOFZXGBZNF-LYTYERHSSA-N |
| XLogP | 6.93 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|