C65H36N2O6 — CID 155228921
2-(3-ethynylphenyl)-5-[6-[9-[6-[2-(3-ethynylphenyl)-1,3-dioxoisoindol-5-yl]oxynaphthalen-2-yl]fluoren-9-yl]naphthalen-2-yl]oxyisoindole-1,3-dione (PubChem CID 155228921) has the molecular formula C65H36N2O6 and a molecular weight of 941.01 g/mol. Its IUPAC name is 2-(3-ethynylphenyl)-5-[6-[9-[6-[2-(3-ethynylphenyl)-1,3-dioxoisoindol-5-yl]oxynaphthalen-2-yl]fluoren-9-yl]naphthalen-2-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-(3-ethynylphenyl)-5-[6-[9-[6-[2-(3-ethynylphenyl)-1,3-dioxoisoindol-5-yl]oxynaphthalen-2-yl]fluoren-9-yl]naphthalen-2-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 155228921 |
| Molecular Formula | C65H36N2O6 |
| Molecular Weight | 941.01 g/mol |
| Exact Mass | 940.26 |
| IUPAC Name | 2-(3-ethynylphenyl)-5-[6-[9-[6-[2-(3-ethynylphenyl)-1,3-dioxoisoindol-5-yl]oxynaphthalen-2-yl]fluoren-9-yl]naphthalen-2-yl]oxyisoindole-1,3-dione |
| SMILES | C#Cc1cccc(N2C(=O)c3ccc(Oc4ccc5cc(C6(c7ccc8cc(Oc9ccc%10c(c9)C(=O)N(c9cccc(C#C)c9)C%10=O)ccc8c7)c7ccccc7-c7ccccc76)ccc5c4)cc3C2=O)c1 |
| InChI | InChI=1S/C65H36N2O6/c1-3-39-11-9-13-47(31-39)66-61(68)55-29-27-51(37-57(55)63(66)70)72-49-25-21-41-33-45(23-19-43(41)35-49)65(59-17-7-5-15-53(59)54-16-6-8-18-60(54)65)46-24-20-44-36-50(26-22-42(44)34-46)73-52-28-30-56-58(38-52)64(71)67(62(56)69)48-14-10-12-40(4-2)32-48/h1-2,5-38H |
| InChIKey | GTINRPUPURJZQO-UHFFFAOYSA-N |
| XLogP | 13.50 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.01 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|