About 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine
3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine (PubChem CID 155229643) has the molecular formula C19H15Cl2N5O
and a molecular weight of 400.27 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine.
Molecular Properties
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine |
| PubChem CID | 155229643 |
| Molecular Formula | C19H15Cl2N5O |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Cc2c(Cl)cccc2Cl)c2nc(-c3ccccc3OC)[nH]c12 |
| InChI | InChI=1S/C19H15Cl2N5O/c1-27-15-8-3-2-5-11(15)18-24-16-17(22)23-10-26(19(16)25-18)9-12-13(20)6-4-7-14(12)21/h2-8,10,22H,9H2,1H3,(H,24,25)/b22-17- |
| InChIKey | ZVINTQUQSNVOQJ-XLNRJJMWSA-N |
| XLogP | 4.27 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine?
The IUPAC name of 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine (CID 155229643) is 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine.
What is the SMILES notation for 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine?
The canonical SMILES for 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine is [H]/N=c1\ncn(Cc2c(Cl)cccc2Cl)c2nc(-c3ccccc3OC)[nH]c12.
What is the InChIKey of 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine?
The InChIKey is ZVINTQUQSNVOQJ-XLNRJJMWSA-N. The full InChI is InChI=1S/C19H15Cl2N5O/c1-27-15-8-3-2-5-11(15)18-24-16-17(22)23-10-26(19(16)25-18)9-12-13(20)6-4-7-14(12)21/h2-8,10,22H,9H2,1H3,(H,24,25)/b22-17-.
What are the key properties of 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine?
3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine has a molecular weight of 400.27 g/mol, XLogP of 4.27, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichlorophenyl)methyl]-8-(2-methoxyphenyl)-7H-purin-6-imine is sourced from PubChem (CID 155229643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).