C42H35ClN6O2S — CID 155229838
3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-6-thiophen-2-ylpyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 155229838) has the molecular formula C42H35ClN6O2S and a molecular weight of 723.30 g/mol. Its IUPAC name is 3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-6-thiophen-2-ylpyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | 3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-6-thiophen-2-ylpyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 155229838 |
| Molecular Formula | C42H35ClN6O2S |
| Molecular Weight | 723.30 g/mol |
| Exact Mass | 722.22 |
| IUPAC Name | 3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-6-thiophen-2-ylpyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | O=C(O)C1C2CCC(CC2)C1Nc1cc(-c2cccs2)nc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ncc(Cl)cc23)n1 |
| InChI | InChI=1S/C42H35ClN6O2S/c43-31-23-32-38(39-45-33(34-17-10-22-52-34)24-35(47-39)46-37-27-20-18-26(19-21-27)36(37)41(50)51)48-49(40(32)44-25-31)42(28-11-4-1-5-12-28,29-13-6-2-7-14-29)30-15-8-3-9-16-30/h1-17,22-27,36-37H,18-21H2,(H,50,51)(H,45,46,47) |
| InChIKey | XXYBLOSNAPYPDH-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.30 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|