C41H36ClFN6O3 — CID 155229849
methyl 3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoro-6-(furan-2-yl)pyrimidin-4-yl]amino]-4,4-dimethylpentanoate (PubChem CID 155229849) has the molecular formula C41H36ClFN6O3 and a molecular weight of 715.23 g/mol. Its IUPAC name is methyl 3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoro-6-(furan-2-yl)pyrimidin-4-yl]amino]-4,4-dimethylpentanoate.
| Compound Name | methyl 3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoro-6-(furan-2-yl)pyrimidin-4-yl]amino]-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 155229849 |
| Molecular Formula | C41H36ClFN6O3 |
| Molecular Weight | 715.23 g/mol |
| Exact Mass | 714.25 |
| IUPAC Name | methyl 3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoro-6-(furan-2-yl)pyrimidin-4-yl]amino]-4,4-dimethylpentanoate |
| SMILES | COC(=O)CC(Nc1nc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ncc(Cl)cc23)nc(-c2ccco2)c1F)C(C)(C)C |
| InChI | InChI=1S/C41H36ClFN6O3/c1-40(2,3)32(24-33(50)51-4)45-37-34(43)36(31-21-14-22-52-31)46-38(47-37)35-30-23-29(42)25-44-39(30)49(48-35)41(26-15-8-5-9-16-26,27-17-10-6-11-18-27)28-19-12-7-13-20-28/h5-23,25,32H,24H2,1-4H3,(H,45,46,47) |
| InChIKey | OXFBHBTWOIADAE-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.23 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|