C42H34ClFN6O3 — CID 155229865
3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoro-6-(furan-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 155229865) has the molecular formula C42H34ClFN6O3 and a molecular weight of 725.22 g/mol. Its IUPAC name is 3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoro-6-(furan-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | 3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoro-6-(furan-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 155229865 |
| Molecular Formula | C42H34ClFN6O3 |
| Molecular Weight | 725.22 g/mol |
| Exact Mass | 724.24 |
| IUPAC Name | 3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoro-6-(furan-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | O=C(O)C1C2CCC(CC2)C1Nc1nc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ncc(Cl)cc23)nc(-c2ccco2)c1F |
| InChI | InChI=1S/C42H34ClFN6O3/c43-30-23-31-36(39-47-37(32-17-10-22-53-32)34(44)38(48-39)46-35-26-20-18-25(19-21-26)33(35)41(51)52)49-50(40(31)45-24-30)42(27-11-4-1-5-12-27,28-13-6-2-7-14-28)29-15-8-3-9-16-29/h1-17,22-26,33,35H,18-21H2,(H,51,52)(H,46,47,48) |
| InChIKey | WKTSGDARTCWBSU-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.22 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|