C20H22F3N7O2S — CID 155230175
[6-[[(Z)-[amino-(1-propan-2-yl-2,3-dihydropyrrolo[2,3-c]pyridin-5-yl)methylidene]carbamothioyl]amino]-5-(trifluoromethyl)-3-pyridinyl] N-methylcarbamate (PubChem CID 155230175) has the molecular formula C20H22F3N7O2S and a molecular weight of 481.50 g/mol. Its IUPAC name is [6-[[(Z)-[amino-(1-propan-2-yl-2,3-dihydropyrrolo[2,3-c]pyridin-5-yl)methylidene]carbamothioyl]amino]-5-(trifluoromethyl)-3-pyridinyl] N-methylcarbamate.
| Compound Name | [6-[[(Z)-[amino-(1-propan-2-yl-2,3-dihydropyrrolo[2,3-c]pyridin-5-yl)methylidene]carbamothioyl]amino]-5-(trifluoromethyl)-3-pyridinyl] N-methylcarbamate |
|---|---|
| PubChem CID | 155230175 |
| Molecular Formula | C20H22F3N7O2S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | [6-[[(Z)-[amino-(1-propan-2-yl-2,3-dihydropyrrolo[2,3-c]pyridin-5-yl)methylidene]carbamothioyl]amino]-5-(trifluoromethyl)-3-pyridinyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cnc(NC(=S)/N=C(\N)c2cc3c(cn2)N(C(C)C)CC3)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H22F3N7O2S/c1-10(2)30-5-4-11-6-14(26-9-15(11)30)16(24)28-18(33)29-17-13(20(21,22)23)7-12(8-27-17)32-19(31)25-3/h6-10H,4-5H2,1-3H3,(H,25,31)(H3,24,27,28,29,33) |
| InChIKey | KSECTATYXSMXEK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|