About (3-chloropyrazin-2-yl) N-methylcarbamate
(3-chloropyrazin-2-yl) N-methylcarbamate (PubChem CID 155230381) has the molecular formula C6H6ClN3O2
and a molecular weight of 187.59 g/mol. Its IUPAC name is (3-chloropyrazin-2-yl) N-methylcarbamate.
Molecular Properties
| Compound Name | (3-chloropyrazin-2-yl) N-methylcarbamate |
| PubChem CID | 155230381 |
| Molecular Formula | C6H6ClN3O2 |
| Molecular Weight | 187.59 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | (3-chloropyrazin-2-yl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1nccnc1Cl |
| InChI | InChI=1S/C6H6ClN3O2/c1-8-6(11)12-5-4(7)9-2-3-10-5/h2-3H,1H3,(H,8,11) |
| InChIKey | SQXJWPUDTQWUOI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.59 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-chloropyrazin-2-yl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloropyrazin-2-yl) N-methylcarbamate?
The IUPAC name of (3-chloropyrazin-2-yl) N-methylcarbamate (CID 155230381) is (3-chloropyrazin-2-yl) N-methylcarbamate.
What is the SMILES notation for (3-chloropyrazin-2-yl) N-methylcarbamate?
The canonical SMILES for (3-chloropyrazin-2-yl) N-methylcarbamate is CNC(=O)Oc1nccnc1Cl.
What is the InChIKey of (3-chloropyrazin-2-yl) N-methylcarbamate?
The InChIKey is SQXJWPUDTQWUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN3O2/c1-8-6(11)12-5-4(7)9-2-3-10-5/h2-3H,1H3,(H,8,11).
What are the key properties of (3-chloropyrazin-2-yl) N-methylcarbamate?
(3-chloropyrazin-2-yl) N-methylcarbamate has a molecular weight of 187.59 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloropyrazin-2-yl) N-methylcarbamate is sourced from PubChem (CID 155230381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).