ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate

C20H24N2O2S — CID 155230917

IUPACethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate
SMILESCCCCCCc1nc2ccccc2n1-c1csc(C(=O)OCC)c1
InChIInChI=1S/C20H24N2O2S/c1-3-5-6-7-12-19-21-16-10-8-9-11-17(16)22(19)15-13-18(25-14-15)20(23)24-4-2/h8-11,13-14H,3-7,12H2,1-2H3
InChIKeyOFZOQQYRZLBGSA-UHFFFAOYSA-N
MW356.49 g/mol
LogP5.39
Rot. Bonds8

About ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate

ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate (PubChem CID 155230917) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate.

Molecular Properties

Compound Nameethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate
PubChem CID155230917
Molecular FormulaC20H24N2O2S
Molecular Weight356.49 g/mol
Exact Mass356.16
IUPAC Nameethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate
SMILESCCCCCCc1nc2ccccc2n1-c1csc(C(=O)OCC)c1
InChIInChI=1S/C20H24N2O2S/c1-3-5-6-7-12-19-21-16-10-8-9-11-17(16)22(19)15-13-18(25-14-15)20(23)24-4-2/h8-11,13-14H,3-7,12H2,1-2H3
InChIKeyOFZOQQYRZLBGSA-UHFFFAOYSA-N
XLogP5.39
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms25
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500356.49
LogP ≤ 55.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate?
The IUPAC name of ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate (CID 155230917) is ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate.
What is the SMILES notation for ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate?
The canonical SMILES for ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate is CCCCCCc1nc2ccccc2n1-c1csc(C(=O)OCC)c1.
What is the InChIKey of ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate?
The InChIKey is OFZOQQYRZLBGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O2S/c1-3-5-6-7-12-19-21-16-10-8-9-11-17(16)22(19)15-13-18(25-14-15)20(23)24-4-2/h8-11,13-14H,3-7,12H2,1-2H3.
What are the key properties of ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate?
ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate has a molecular weight of 356.49 g/mol, XLogP of 5.39, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2-hexylbenzimidazol-1-yl)thiophene-2-carboxylate is sourced from PubChem (CID 155230917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).