C19H16N4OS — CID 155230921
N-[(4-aminophenyl)methyl]-4-(benzimidazol-1-yl)thiophene-2-carboxamide (PubChem CID 155230921) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-4-(benzimidazol-1-yl)thiophene-2-carboxamide.
| Compound Name | N-[(4-aminophenyl)methyl]-4-(benzimidazol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 155230921 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-4-(benzimidazol-1-yl)thiophene-2-carboxamide |
| SMILES | Nc1ccc(CNC(=O)c2cc(-n3cnc4ccccc43)cs2)cc1 |
| InChI | InChI=1S/C19H16N4OS/c20-14-7-5-13(6-8-14)10-21-19(24)18-9-15(11-25-18)23-12-22-16-3-1-2-4-17(16)23/h1-9,11-12H,10,20H2,(H,21,24) |
| InChIKey | NCOWISRIOUNDLI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|