C9H9F3N2O2S — CID 155231017
(E)-N-methoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine (PubChem CID 155231017) has the molecular formula C9H9F3N2O2S and a molecular weight of 266.24 g/mol. Its IUPAC name is (E)-N-methoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine.
| Compound Name | (E)-N-methoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine |
|---|---|
| PubChem CID | 155231017 |
| Molecular Formula | C9H9F3N2O2S |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | (E)-N-methoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine |
| SMILES | CO/N=C/c1cnc(SCCC(F)=C(F)F)o1 |
| InChI | InChI=1S/C9H9F3N2O2S/c1-15-14-5-6-4-13-9(16-6)17-3-2-7(10)8(11)12/h4-5H,2-3H2,1H3/b14-5+ |
| InChIKey | RHCYOUBGKACEDZ-LHHJGKSTSA-N |
| XLogP | 3.21 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|