About (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone
(5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone (PubChem CID 155231612) has the molecular formula C15H12F2N2O2S
and a molecular weight of 322.34 g/mol. Its IUPAC name is (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone.
Molecular Properties
| Compound Name | (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone |
| PubChem CID | 155231612 |
| Molecular Formula | C15H12F2N2O2S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone |
| SMILES | CC[C@@H](O)c1csc(C(=O)c2c[nH]c3c(F)cc(F)cc23)n1 |
| InChI | InChI=1S/C15H12F2N2O2S/c1-2-12(20)11-6-22-15(19-11)14(21)9-5-18-13-8(9)3-7(16)4-10(13)17/h3-6,12,18,20H,2H2,1H3/t12-/m1/s1 |
| InChIKey | RIQIIWQISIYBPZ-GFCCVEGCSA-N |
| XLogP | 3.58 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone?
The IUPAC name of (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone (CID 155231612) is (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone.
What is the SMILES notation for (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone?
The canonical SMILES for (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone is CC[C@@H](O)c1csc(C(=O)c2c[nH]c3c(F)cc(F)cc23)n1.
What is the InChIKey of (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone?
The InChIKey is RIQIIWQISIYBPZ-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H12F2N2O2S/c1-2-12(20)11-6-22-15(19-11)14(21)9-5-18-13-8(9)3-7(16)4-10(13)17/h3-6,12,18,20H,2H2,1H3/t12-/m1/s1.
What are the key properties of (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone?
(5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone has a molecular weight of 322.34 g/mol, XLogP of 3.58, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-difluoro-1H-indol-3-yl)-[4-[(1R)-1-hydroxypropyl]-1,3-thiazol-2-yl]methanone is sourced from PubChem (CID 155231612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).