C24H27F3N8O2 — CID 155232034
2-amino-N-butan-2-yl-6-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propyl]pyrazol-4-yl]-[1,2,4]triazolo[1,5-a]pyridine-8-carboxamide (PubChem CID 155232034) has the molecular formula C24H27F3N8O2 and a molecular weight of 516.53 g/mol. Its IUPAC name is 2-amino-N-butan-2-yl-6-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propyl]pyrazol-4-yl]-[1,2,4]triazolo[1,5-a]pyridine-8-carboxamide.
| Compound Name | 2-amino-N-butan-2-yl-6-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propyl]pyrazol-4-yl]-[1,2,4]triazolo[1,5-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 155232034 |
| Molecular Formula | C24H27F3N8O2 |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 2-amino-N-butan-2-yl-6-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propyl]pyrazol-4-yl]-[1,2,4]triazolo[1,5-a]pyridine-8-carboxamide |
| SMILES | CCC(C)NC(=O)c1cc(-c2cnn(C(CC)c3ccc(OCC(F)(F)F)nc3)c2)cn2nc(N)nc12 |
| InChI | InChI=1S/C24H27F3N8O2/c1-4-14(3)31-22(36)18-8-16(11-35-21(18)32-23(28)33-35)17-10-30-34(12-17)19(5-2)15-6-7-20(29-9-15)37-13-24(25,26)27/h6-12,14,19H,4-5,13H2,1-3H3,(H2,28,33)(H,31,36) |
| InChIKey | ZKNDCAGPXCSTRY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |