C67H37F12N5 — CID 155232340
3,6-bis[2,4-bis(trifluoromethyl)phenyl]-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-1-yl)phenyl]carbazole (PubChem CID 155232340) has the molecular formula C67H37F12N5 and a molecular weight of 1140.04 g/mol. Its IUPAC name is 3,6-bis[2,4-bis(trifluoromethyl)phenyl]-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-1-yl)phenyl]carbazole.
| Compound Name | 3,6-bis[2,4-bis(trifluoromethyl)phenyl]-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-1-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 155232340 |
| Molecular Formula | C67H37F12N5 |
| Molecular Weight | 1140.04 g/mol |
| Exact Mass | 1139.29 |
| IUPAC Name | 3,6-bis[2,4-bis(trifluoromethyl)phenyl]-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-1-yl)phenyl]carbazole |
| SMILES | FC(F)(F)c1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)ccc2n3-c2ccc(-c3cccc4c5ccccc5n(-c5ccccc5)c34)cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C67H37F12N5/c68-64(69,70)43-26-28-46(54(36-43)66(74,75)76)40-23-30-57-51(33-40)52-34-41(47-29-27-44(65(71,72)73)37-55(47)67(77,78)79)24-31-58(52)84(57)59-32-25-42(48-20-12-21-50-49-19-10-11-22-56(49)83(60(48)50)45-17-8-3-9-18-45)35-53(59)63-81-61(38-13-4-1-5-14-38)80-62(82-63)39-15-6-2-7-16-39/h1-37H |
| InChIKey | SUHXTLYPURUUPG-UHFFFAOYSA-N |
| XLogP | 20.14 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1140.04 |
| LogP ≤ 5 | 20.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |