C17H17NO2S — CID 155233699
6-benzylthieno[3,2-c]pyridine;ethyl formate (PubChem CID 155233699) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 6-benzylthieno[3,2-c]pyridine;ethyl formate.
| Compound Name | 6-benzylthieno[3,2-c]pyridine;ethyl formate |
|---|---|
| PubChem CID | 155233699 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 6-benzylthieno[3,2-c]pyridine;ethyl formate |
| SMILES | CCOC=O.c1ccc(Cc2cc3sccc3cn2)cc1 |
| InChI | InChI=1S/C14H11NS.C3H6O2/c1-2-4-11(5-3-1)8-13-9-14-12(10-15-13)6-7-16-14;1-2-5-3-4/h1-7,9-10H,8H2;3H,2H2,1H3 |
| InChIKey | MRTVUUUZRANFNT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|