About 6-benzylthieno[3,2-c]pyridine
6-benzylthieno[3,2-c]pyridine (PubChem CID 155233700) has the molecular formula C14H11NS
and a molecular weight of 225.32 g/mol. Its IUPAC name is 6-benzylthieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 6-benzylthieno[3,2-c]pyridine |
| PubChem CID | 155233700 |
| Molecular Formula | C14H11NS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 6-benzylthieno[3,2-c]pyridine |
| SMILES | c1ccc(Cc2cc3sccc3cn2)cc1 |
| InChI | InChI=1S/C14H11NS/c1-2-4-11(5-3-1)8-13-9-14-12(10-15-13)6-7-16-14/h1-7,9-10H,8H2 |
| InChIKey | QZORKRYWMPQKJA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-benzylthieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzylthieno[3,2-c]pyridine?
The IUPAC name of 6-benzylthieno[3,2-c]pyridine (CID 155233700) is 6-benzylthieno[3,2-c]pyridine.
What is the SMILES notation for 6-benzylthieno[3,2-c]pyridine?
The canonical SMILES for 6-benzylthieno[3,2-c]pyridine is c1ccc(Cc2cc3sccc3cn2)cc1.
What is the InChIKey of 6-benzylthieno[3,2-c]pyridine?
The InChIKey is QZORKRYWMPQKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NS/c1-2-4-11(5-3-1)8-13-9-14-12(10-15-13)6-7-16-14/h1-7,9-10H,8H2.
What are the key properties of 6-benzylthieno[3,2-c]pyridine?
6-benzylthieno[3,2-c]pyridine has a molecular weight of 225.32 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzylthieno[3,2-c]pyridine is sourced from PubChem (CID 155233700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).