About [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde
[(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde (PubChem CID 155233836) has the molecular formula C10H8N3O2P
and a molecular weight of 233.17 g/mol. Its IUPAC name is [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde.
Molecular Properties
| Compound Name | [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde |
| PubChem CID | 155233836 |
| Molecular Formula | C10H8N3O2P |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde |
| SMILES | Nc1cnc2cccnc2c1P(C=O)C=O |
| InChI | InChI=1S/C10H8N3O2P/c11-7-4-13-8-2-1-3-12-9(8)10(7)16(5-14)6-15/h1-6H,11H2 |
| InChIKey | HSXWGFKSYLXLFT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde?
The IUPAC name of [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde (CID 155233836) is [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde.
What is the SMILES notation for [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde?
The canonical SMILES for [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde is Nc1cnc2cccnc2c1P(C=O)C=O.
What is the InChIKey of [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde?
The InChIKey is HSXWGFKSYLXLFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N3O2P/c11-7-4-13-8-2-1-3-12-9(8)10(7)16(5-14)6-15/h1-6H,11H2.
What are the key properties of [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde?
[(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde has a molecular weight of 233.17 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-amino-1,5-naphthyridin-4-yl)-formylphosphanyl]formaldehyde is sourced from PubChem (CID 155233836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).