About (3-phenyl-2-pyridinyl) carbamate
(3-phenyl-2-pyridinyl) carbamate (PubChem CID 155234314) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is (3-phenyl-2-pyridinyl) carbamate.
Molecular Properties
| Compound Name | (3-phenyl-2-pyridinyl) carbamate |
| PubChem CID | 155234314 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | (3-phenyl-2-pyridinyl) carbamate |
| SMILES | NC(=O)Oc1ncccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10N2O2/c13-12(15)16-11-10(7-4-8-14-11)9-5-2-1-3-6-9/h1-8H,(H2,13,15) |
| InChIKey | YAWYCMREIRBQMW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-phenyl-2-pyridinyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-2-pyridinyl) carbamate?
The IUPAC name of (3-phenyl-2-pyridinyl) carbamate (CID 155234314) is (3-phenyl-2-pyridinyl) carbamate.
What is the SMILES notation for (3-phenyl-2-pyridinyl) carbamate?
The canonical SMILES for (3-phenyl-2-pyridinyl) carbamate is NC(=O)Oc1ncccc1-c1ccccc1.
What is the InChIKey of (3-phenyl-2-pyridinyl) carbamate?
The InChIKey is YAWYCMREIRBQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c13-12(15)16-11-10(7-4-8-14-11)9-5-2-1-3-6-9/h1-8H,(H2,13,15).
What are the key properties of (3-phenyl-2-pyridinyl) carbamate?
(3-phenyl-2-pyridinyl) carbamate has a molecular weight of 214.22 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-2-pyridinyl) carbamate is sourced from PubChem (CID 155234314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).