C22H21BrFN3O2 — CID 155235163
(3R,4R)-4-[4-(2-bromo-4-pyridinyl)-5-(4-fluorophenyl)-1H-pyrrol-2-yl]-3-methylpiperidine-1-carboxylic acid (PubChem CID 155235163) has the molecular formula C22H21BrFN3O2 and a molecular weight of 458.33 g/mol. Its IUPAC name is (3R,4R)-4-[4-(2-bromo-4-pyridinyl)-5-(4-fluorophenyl)-1H-pyrrol-2-yl]-3-methylpiperidine-1-carboxylic acid.
| Compound Name | (3R,4R)-4-[4-(2-bromo-4-pyridinyl)-5-(4-fluorophenyl)-1H-pyrrol-2-yl]-3-methylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155235163 |
| Molecular Formula | C22H21BrFN3O2 |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | (3R,4R)-4-[4-(2-bromo-4-pyridinyl)-5-(4-fluorophenyl)-1H-pyrrol-2-yl]-3-methylpiperidine-1-carboxylic acid |
| SMILES | C[C@H]1CN(C(=O)O)CC[C@H]1c1cc(-c2ccnc(Br)c2)c(-c2ccc(F)cc2)[nH]1 |
| InChI | InChI=1S/C22H21BrFN3O2/c1-13-12-27(22(28)29)9-7-17(13)19-11-18(15-6-8-25-20(23)10-15)21(26-19)14-2-4-16(24)5-3-14/h2-6,8,10-11,13,17,26H,7,9,12H2,1H3,(H,28,29)/t13-,17+/m0/s1 |
| InChIKey | ZPYBFYMMEUOPPN-SUMWQHHRSA-N |
| XLogP | 5.75 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|