C26H29BrFN3O2 — CID 155235172
tert-butyl (3R,4S)-4-[4-(2-bromo-4-pyridinyl)-5-(4-fluorophenyl)-1H-pyrrol-2-yl]-3-methylpiperidine-1-carboxylate (PubChem CID 155235172) has the molecular formula C26H29BrFN3O2 and a molecular weight of 514.44 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-[4-(2-bromo-4-pyridinyl)-5-(4-fluorophenyl)-1H-pyrrol-2-yl]-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-4-[4-(2-bromo-4-pyridinyl)-5-(4-fluorophenyl)-1H-pyrrol-2-yl]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155235172 |
| Molecular Formula | C26H29BrFN3O2 |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | tert-butyl (3R,4S)-4-[4-(2-bromo-4-pyridinyl)-5-(4-fluorophenyl)-1H-pyrrol-2-yl]-3-methylpiperidine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CC[C@@H]1c1cc(-c2ccnc(Br)c2)c(-c2ccc(F)cc2)[nH]1 |
| InChI | InChI=1S/C26H29BrFN3O2/c1-16-15-31(25(32)33-26(2,3)4)12-10-20(16)22-14-21(18-9-11-29-23(27)13-18)24(30-22)17-5-7-19(28)8-6-17/h5-9,11,13-14,16,20,30H,10,12,15H2,1-4H3/t16-,20-/m0/s1 |
| InChIKey | RYLQAFZCABKEGQ-JXFKEZNVSA-N |
| XLogP | 7.01 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|