About 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea
3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea (PubChem CID 155235293) has the molecular formula C14H22N4O2S
and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea.
Molecular Properties
| Compound Name | 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea |
| PubChem CID | 155235293 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea |
| SMILES | COCCOCc1ccnc(/C(C)=N/NC(=S)N(C)C)c1 |
| InChI | InChI=1S/C14H22N4O2S/c1-11(16-17-14(21)18(2)3)13-9-12(5-6-15-13)10-20-8-7-19-4/h5-6,9H,7-8,10H2,1-4H3,(H,17,21)/b16-11+ |
| InChIKey | FFFXGIXWORPVEZ-LFIBNONCSA-N |
| XLogP | 1.40 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea?
The IUPAC name of 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea (CID 155235293) is 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea.
What is the SMILES notation for 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea?
The canonical SMILES for 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea is COCCOCc1ccnc(/C(C)=N/NC(=S)N(C)C)c1.
What is the InChIKey of 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea?
The InChIKey is FFFXGIXWORPVEZ-LFIBNONCSA-N. The full InChI is InChI=1S/C14H22N4O2S/c1-11(16-17-14(21)18(2)3)13-9-12(5-6-15-13)10-20-8-7-19-4/h5-6,9H,7-8,10H2,1-4H3,(H,17,21)/b16-11+.
What are the key properties of 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea?
3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea has a molecular weight of 310.42 g/mol, XLogP of 1.40, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-1-[4-(2-methoxyethoxymethyl)-2-pyridinyl]ethylideneamino]-1,1-dimethylthiourea is sourced from PubChem (CID 155235293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).