About [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide
[4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide (PubChem CID 155235342) has the molecular formula C18H15BrF3N3O2S
and a molecular weight of 474.30 g/mol. Its IUPAC name is [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide.
Molecular Properties
| Compound Name | [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide |
| PubChem CID | 155235342 |
| Molecular Formula | C18H15BrF3N3O2S |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SCc1ccc(CN2C(=O)C(=O)c3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C18H14F3N3O2S.BrH/c19-18(20,21)12-5-6-14-13(7-12)15(25)16(26)24(14)8-10-1-3-11(4-2-10)9-27-17(22)23;/h1-7H,8-9H2,(H3,22,23);1H |
| InChIKey | AHVSKNDQJSDEMD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide?
The IUPAC name of [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide (CID 155235342) is [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide.
What is the SMILES notation for [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide?
The canonical SMILES for [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide is Br.[H]/N=C(\N)SCc1ccc(CN2C(=O)C(=O)c3cc(C(F)(F)F)ccc32)cc1.
What is the InChIKey of [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide?
The InChIKey is AHVSKNDQJSDEMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3N3O2S.BrH/c19-18(20,21)12-5-6-14-13(7-12)15(25)16(26)24(14)8-10-1-3-11(4-2-10)9-27-17(22)23;/h1-7H,8-9H2,(H3,22,23);1H.
What are the key properties of [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide?
[4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide has a molecular weight of 474.30 g/mol, XLogP of 4.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]methyl]phenyl]methyl carbamimidothioate;hydrobromide is sourced from PubChem (CID 155235342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).