About 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol
4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol (PubChem CID 155235882) has the molecular formula C28H36N2O2
and a molecular weight of 432.61 g/mol. Its IUPAC name is 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol.
Molecular Properties
| Compound Name | 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol |
| PubChem CID | 155235882 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCc1cc(-c2cccc(N)c2)c(CCC(C)(C)O)cc1-c1cccc(N)c1 |
| InChI | InChI=1S/C28H36N2O2/c1-27(2,31)13-11-21-17-26(20-8-6-10-24(30)16-20)22(12-14-28(3,4)32)18-25(21)19-7-5-9-23(29)15-19/h5-10,15-18,31-32H,11-14,29-30H2,1-4H3 |
| InChIKey | PJIMIGMOLPJJFO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol?
The IUPAC name of 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol (CID 155235882) is 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol.
What is the SMILES notation for 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol?
The canonical SMILES for 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol is CC(C)(O)CCc1cc(-c2cccc(N)c2)c(CCC(C)(C)O)cc1-c1cccc(N)c1.
What is the InChIKey of 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol?
The InChIKey is PJIMIGMOLPJJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H36N2O2/c1-27(2,31)13-11-21-17-26(20-8-6-10-24(30)16-20)22(12-14-28(3,4)32)18-25(21)19-7-5-9-23(29)15-19/h5-10,15-18,31-32H,11-14,29-30H2,1-4H3.
What are the key properties of 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol?
4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol has a molecular weight of 432.61 g/mol, XLogP of 5.59, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,5-bis(3-aminophenyl)-4-(3-hydroxy-3-methylbutyl)phenyl]-2-methylbutan-2-ol is sourced from PubChem (CID 155235882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).