C33H50N2O7 — CID 155236140
[(4E,6E,12E,18E)-11,14-dihydroxy-4-methyl-2-[(E)-4-methyl-6-(3-methylbut-3-enoylamino)hex-3-en-2-yl]-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate (PubChem CID 155236140) has the molecular formula C33H50N2O7 and a molecular weight of 586.77 g/mol. Its IUPAC name is [(4E,6E,12E,18E)-11,14-dihydroxy-4-methyl-2-[(E)-4-methyl-6-(3-methylbut-3-enoylamino)hex-3-en-2-yl]-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate.
| Compound Name | [(4E,6E,12E,18E)-11,14-dihydroxy-4-methyl-2-[(E)-4-methyl-6-(3-methylbut-3-enoylamino)hex-3-en-2-yl]-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate |
|---|---|
| PubChem CID | 155236140 |
| Molecular Formula | C33H50N2O7 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.36 |
| IUPAC Name | [(4E,6E,12E,18E)-11,14-dihydroxy-4-methyl-2-[(E)-4-methyl-6-(3-methylbut-3-enoylamino)hex-3-en-2-yl]-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate |
| SMILES | C=C(C)CC(=O)NCC/C(C)=C/C(C)C1C/C(C)=C/C=C/CCC(OC(N)=O)C(O)/C=C/C(O)CCC/C=C/C(=O)O1 |
| InChI | InChI=1S/C33H50N2O7/c1-23(2)20-31(38)35-19-18-25(4)21-26(5)30-22-24(3)12-8-6-10-14-29(42-33(34)40)28(37)17-16-27(36)13-9-7-11-15-32(39)41-30/h6,8,11-12,15-17,21,26-30,36-37H,1,7,9-10,13-14,18-20,22H2,2-5H3,(H2,34,40)(H,35,38)/b8-6+,15-11+,17-16+,24-12+,25-21+ |
| InChIKey | AIFCGGWPMHGRMB-BWSGVKNLSA-N |
| XLogP | 5.11 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|