C47H42F6O11 — CID 155236259
[4-[1,3-bis[[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-6-yl]oxy]propan-2-yloxy]-2,4-dimethylpentan-2-yl] prop-2-enoate (PubChem CID 155236259) has the molecular formula C47H42F6O11 and a molecular weight of 896.83 g/mol. Its IUPAC name is [4-[1,3-bis[[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-6-yl]oxy]propan-2-yloxy]-2,4-dimethylpentan-2-yl] prop-2-enoate.
| Compound Name | [4-[1,3-bis[[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-6-yl]oxy]propan-2-yloxy]-2,4-dimethylpentan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 155236259 |
| Molecular Formula | C47H42F6O11 |
| Molecular Weight | 896.83 g/mol |
| Exact Mass | 896.26 |
| IUPAC Name | [4-[1,3-bis[[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-6-yl]oxy]propan-2-yloxy]-2,4-dimethylpentan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)CC(C)(C)OC(COc1ccc2oc(=O)c(-c3ccc(C)cc3OC(F)(F)F)cc2c1)COc1ccc2oc(=O)c(-c3ccc(C)cc3OC(F)(F)F)cc2c1 |
| InChI | InChI=1S/C47H42F6O11/c1-8-41(54)64-45(6,7)25-44(4,5)61-32(23-57-30-11-15-37-28(19-30)21-35(42(55)59-37)33-13-9-26(2)17-39(33)62-46(48,49)50)24-58-31-12-16-38-29(20-31)22-36(43(56)60-38)34-14-10-27(3)18-40(34)63-47(51,52)53/h8-22,32H,1,23-25H2,2-7H3 |
| InChIKey | WCWGBSMMHQOIFD-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 132.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.83 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|