C29H42N3O2P — CID 155236552
1-[(3S,8S,10R,13S,17S)-10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(5-phosphanylbenzotriazol-2-yl)ethanone (PubChem CID 155236552) has the molecular formula C29H42N3O2P and a molecular weight of 495.65 g/mol. Its IUPAC name is 1-[(3S,8S,10R,13S,17S)-10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(5-phosphanylbenzotriazol-2-yl)ethanone.
| Compound Name | 1-[(3S,8S,10R,13S,17S)-10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(5-phosphanylbenzotriazol-2-yl)ethanone |
|---|---|
| PubChem CID | 155236552 |
| Molecular Formula | C29H42N3O2P |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | 1-[(3S,8S,10R,13S,17S)-10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(5-phosphanylbenzotriazol-2-yl)ethanone |
| SMILES | COC[C@]12CC[C@H](C)CC1CC[C@@H]1C2CC[C@@]2(C)C1CC[C@@H]2C(=O)Cn1nc2ccc(P)cc2n1 |
| InChI | InChI=1S/C29H42N3O2P/c1-18-10-13-29(17-34-3)19(14-18)4-6-21-22-7-8-24(28(22,2)12-11-23(21)29)27(33)16-32-30-25-9-5-20(35)15-26(25)31-32/h5,9,15,18-19,21-24H,4,6-8,10-14,16-17,35H2,1-3H3/t18-,19?,21-,22?,23?,24+,28-,29+/m0/s1 |
| InChIKey | MTSSOTNSNFMKBY-DCRXWRBWSA-N |
| XLogP | 5.42 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|