About 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine
3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine (PubChem CID 155236663) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine.
Molecular Properties
| Compound Name | 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine |
| PubChem CID | 155236663 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine |
| SMILES | CCCC(C)(C)NC(CC)(CC)NC1CO1 |
| InChI | InChI=1S/C13H28N2O/c1-6-9-12(4,5)15-13(7-2,8-3)14-11-10-16-11/h11,14-15H,6-10H2,1-5H3 |
| InChIKey | HSSLYNGZYWCWOD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 36.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine?
The IUPAC name of 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine (CID 155236663) is 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine.
What is the SMILES notation for 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine?
The canonical SMILES for 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine is CCCC(C)(C)NC(CC)(CC)NC1CO1.
What is the InChIKey of 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine?
The InChIKey is HSSLYNGZYWCWOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O/c1-6-9-12(4,5)15-13(7-2,8-3)14-11-10-16-11/h11,14-15H,6-10H2,1-5H3.
What are the key properties of 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine?
3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine has a molecular weight of 228.38 g/mol, XLogP of 2.62, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N'-(2-methylpentan-2-yl)-3-N-(oxiran-2-yl)pentane-3,3-diamine is sourced from PubChem (CID 155236663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).