About 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine
3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine (PubChem CID 155236766) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine |
| PubChem CID | 155236766 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine |
| SMILES | C=CCN(CC=C)C(=C)C(=C)F |
| InChI | InChI=1S/C10H14FN/c1-5-7-12(8-6-2)10(4)9(3)11/h5-6H,1-4,7-8H2 |
| InChIKey | PSJUBIHOZLUFNN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine?
The IUPAC name of 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine (CID 155236766) is 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine.
What is the SMILES notation for 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine?
The canonical SMILES for 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine is C=CCN(CC=C)C(=C)C(=C)F.
What is the InChIKey of 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine?
The InChIKey is PSJUBIHOZLUFNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN/c1-5-7-12(8-6-2)10(4)9(3)11/h5-6H,1-4,7-8H2.
What are the key properties of 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine?
3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine has a molecular weight of 167.23 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N,N-bis(prop-2-enyl)buta-1,3-dien-2-amine is sourced from PubChem (CID 155236766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).