C52H38N5OP — CID 155236787
5-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenylpyrimidin-2-yl)carbazol-3-yl]-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide (PubChem CID 155236787) has the molecular formula C52H38N5OP and a molecular weight of 779.88 g/mol. Its IUPAC name is 5-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenylpyrimidin-2-yl)carbazol-3-yl]-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide.
| Compound Name | 5-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenylpyrimidin-2-yl)carbazol-3-yl]-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide |
|---|---|
| PubChem CID | 155236787 |
| Molecular Formula | C52H38N5OP |
| Molecular Weight | 779.88 g/mol |
| Exact Mass | 779.28 |
| IUPAC Name | 5-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenylpyrimidin-2-yl)carbazol-3-yl]-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide |
| SMILES | O=P1(c2ccccc2)N(c2ccccc2)c2ccc(-c3ccc4c(c3)c3ccccc3n4-c3nc(-c4ccccc4)cc(C4C=CC=CC4)n3)cc2N1c1ccccc1 |
| InChI | InChI=1S/C52H38N5OP/c58-59(43-26-14-5-15-27-43)56(41-22-10-3-11-23-41)50-33-31-40(35-51(50)57(59)42-24-12-4-13-25-42)39-30-32-49-45(34-39)44-28-16-17-29-48(44)55(49)52-53-46(37-18-6-1-7-19-37)36-47(54-52)38-20-8-2-9-21-38/h1-20,22-36,38H,21H2 |
| InChIKey | FVUTZAXIEWQNJV-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.88 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|