C15H23N — CID 155237330
3-methyl-1-propan-2-yl-2-[(Z)-prop-1-enyl]-3a,4,5,7a-tetrahydroindole (PubChem CID 155237330) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 3-methyl-1-propan-2-yl-2-[(Z)-prop-1-enyl]-3a,4,5,7a-tetrahydroindole.
| Compound Name | 3-methyl-1-propan-2-yl-2-[(Z)-prop-1-enyl]-3a,4,5,7a-tetrahydroindole |
|---|---|
| PubChem CID | 155237330 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 3-methyl-1-propan-2-yl-2-[(Z)-prop-1-enyl]-3a,4,5,7a-tetrahydroindole |
| SMILES | C/C=C\C1=C(C)C2CCC=CC2N1C(C)C |
| InChI | InChI=1S/C15H23N/c1-5-8-14-12(4)13-9-6-7-10-15(13)16(14)11(2)3/h5,7-8,10-11,13,15H,6,9H2,1-4H3/b8-5- |
| InChIKey | CGMJCRGLNWCZOZ-YVMONPNESA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|