C12H18F6N2O7S2 — CID 155237467
1,1,2,2,3,3-hexafluoro-3-[2-[(2-oxooxolan-3-yl)-propylamino]ethylsulfamoyl]propane-1-sulfonic acid (PubChem CID 155237467) has the molecular formula C12H18F6N2O7S2 and a molecular weight of 480.41 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[2-[(2-oxooxolan-3-yl)-propylamino]ethylsulfamoyl]propane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[2-[(2-oxooxolan-3-yl)-propylamino]ethylsulfamoyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 155237467 |
| Molecular Formula | C12H18F6N2O7S2 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[2-[(2-oxooxolan-3-yl)-propylamino]ethylsulfamoyl]propane-1-sulfonic acid |
| SMILES | CCCN(CCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)C1CCOC1=O |
| InChI | InChI=1S/C12H18F6N2O7S2/c1-2-5-20(8-3-7-27-9(8)21)6-4-19-28(22,23)11(15,16)10(13,14)12(17,18)29(24,25)26/h8,19H,2-7H2,1H3,(H,24,25,26) |
| InChIKey | QYGNIJXCHMMGPU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|