C7H5Cl2N — CID 155237699
2,4-dichloro-7-methyl-1-azacyclohepta-2,4,5,7-tetraene (PubChem CID 155237699) has the molecular formula C7H5Cl2N and a molecular weight of 174.03 g/mol. Its IUPAC name is 2,4-dichloro-7-methyl-1-azacyclohepta-2,4,5,7-tetraene.
| Compound Name | 2,4-dichloro-7-methyl-1-azacyclohepta-2,4,5,7-tetraene |
|---|---|
| PubChem CID | 155237699 |
| Molecular Formula | C7H5Cl2N |
| Molecular Weight | 174.03 g/mol |
| Exact Mass | 172.98 |
| IUPAC Name | 2,4-dichloro-7-methyl-1-azacyclohepta-2,4,5,7-tetraene |
| SMILES | CC1=NC(Cl)=CC(Cl)=C=C1 |
| InChI | InChI=1S/C7H5Cl2N/c1-5-2-3-6(8)4-7(9)10-5/h2,4H,1H3 |
| InChIKey | CJKGTIZVFDPUIN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.03 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|