C26H27ClF3NS — CID 155238004
(3R)-3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]butane-1-thiol (PubChem CID 155238004) has the molecular formula C26H27ClF3NS and a molecular weight of 478.02 g/mol. Its IUPAC name is (3R)-3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]butane-1-thiol.
| Compound Name | (3R)-3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]butane-1-thiol |
|---|---|
| PubChem CID | 155238004 |
| Molecular Formula | C26H27ClF3NS |
| Molecular Weight | 478.02 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (3R)-3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]butane-1-thiol |
| SMILES | C[C@H](CCS)N(Cc1cccc(C(F)(F)F)c1Cl)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27ClF3NS/c1-19(15-16-32)31(17-22-13-8-14-24(25(22)27)26(28,29)30)18-23(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-14,19,23,32H,15-18H2,1H3/t19-/m1/s1 |
| InChIKey | QXIMAURVMNZNON-LJQANCHMSA-N |
| XLogP | 7.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.02 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|