About 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate
2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate (PubChem CID 155238022) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate.
Molecular Properties
| Compound Name | 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate |
| PubChem CID | 155238022 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate |
| SMILES | CCC(=O)OCCOC(=O)[C@@H](C)[C@@H]1CCCC(C)(C)C1 |
| InChI | InChI=1S/C16H28O4/c1-5-14(17)19-9-10-20-15(18)12(2)13-7-6-8-16(3,4)11-13/h12-13H,5-11H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | NXXLZUSSCXHTOE-QWHCGFSZSA-N |
| XLogP | 3.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate?
The IUPAC name of 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate (CID 155238022) is 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate.
What is the SMILES notation for 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate?
The canonical SMILES for 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate is CCC(=O)OCCOC(=O)[C@@H](C)[C@@H]1CCCC(C)(C)C1.
What is the InChIKey of 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate?
The InChIKey is NXXLZUSSCXHTOE-QWHCGFSZSA-N. The full InChI is InChI=1S/C16H28O4/c1-5-14(17)19-9-10-20-15(18)12(2)13-7-6-8-16(3,4)11-13/h12-13H,5-11H2,1-4H3/t12-,13+/m0/s1.
What are the key properties of 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate?
2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate has a molecular weight of 284.40 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propanoyloxyethyl (2S)-2-[(1R)-3,3-dimethylcyclohexyl]propanoate is sourced from PubChem (CID 155238022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).