C26H33FN2O3 — CID 155238172
(E,4E)-4-[(Z)-2-(2-fluoro-1-phenylethyl)-3-methylpent-2-enylidene]-N,2-dimethyl-N'-(3-oxabicyclo[3.1.0]hexan-6-yl)pent-2-enediamide (PubChem CID 155238172) has the molecular formula C26H33FN2O3 and a molecular weight of 440.56 g/mol. Its IUPAC name is (E,4E)-4-[(Z)-2-(2-fluoro-1-phenylethyl)-3-methylpent-2-enylidene]-N,2-dimethyl-N'-(3-oxabicyclo[3.1.0]hexan-6-yl)pent-2-enediamide.
| Compound Name | (E,4E)-4-[(Z)-2-(2-fluoro-1-phenylethyl)-3-methylpent-2-enylidene]-N,2-dimethyl-N'-(3-oxabicyclo[3.1.0]hexan-6-yl)pent-2-enediamide |
|---|---|
| PubChem CID | 155238172 |
| Molecular Formula | C26H33FN2O3 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | (E,4E)-4-[(Z)-2-(2-fluoro-1-phenylethyl)-3-methylpent-2-enylidene]-N,2-dimethyl-N'-(3-oxabicyclo[3.1.0]hexan-6-yl)pent-2-enediamide |
| SMILES | CC/C(C)=C(/C=C(\C=C(/C)C(=O)NC)C(=O)NC1C2COCC21)C(CF)c1ccccc1 |
| InChI | InChI=1S/C26H33FN2O3/c1-5-16(2)20(21(13-27)18-9-7-6-8-10-18)12-19(11-17(3)25(30)28-4)26(31)29-24-22-14-32-15-23(22)24/h6-12,21-24H,5,13-15H2,1-4H3,(H,28,30)(H,29,31)/b17-11+,19-12+,20-16- |
| InChIKey | CDWITUDYPFADRQ-ZZZUMXHQSA-N |
| XLogP | 3.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|