C52H40N4 — CID 155238326
3-(9-cyclohexa-2,4-dien-1-yl-4,4a,4b,8a-tetrahydrocarbazol-3-yl)-9-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole (PubChem CID 155238326) has the molecular formula C52H40N4 and a molecular weight of 720.92 g/mol. Its IUPAC name is 3-(9-cyclohexa-2,4-dien-1-yl-4,4a,4b,8a-tetrahydrocarbazol-3-yl)-9-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole.
| Compound Name | 3-(9-cyclohexa-2,4-dien-1-yl-4,4a,4b,8a-tetrahydrocarbazol-3-yl)-9-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 155238326 |
| Molecular Formula | C52H40N4 |
| Molecular Weight | 720.92 g/mol |
| Exact Mass | 720.33 |
| IUPAC Name | 3-(9-cyclohexa-2,4-dien-1-yl-4,4a,4b,8a-tetrahydrocarbazol-3-yl)-9-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole |
| SMILES | C1=CCC(N2C3=CC=C(c4ccc5c(c4)c4ccccc4n5-c4cccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)c4)CC3C3C=CC=CC32)C=C1 |
| InChI | InChI=1S/C52H40N4/c1-4-15-35(16-5-1)46-34-47(36-17-6-2-7-18-36)54-52(53-46)39-19-14-22-41(31-39)56-49-26-13-11-24-43(49)45-33-38(28-30-51(45)56)37-27-29-50-44(32-37)42-23-10-12-25-48(42)55(50)40-20-8-3-9-21-40/h1-20,22-31,33-34,40,42,44,48H,21,32H2 |
| InChIKey | QCXNOUSGZFJPOL-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.92 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |