C19H30N2 — CID 155238505
(5Z,7Z)-8-butyl-12-methyl-3,11-diazabicyclo[11.3.0]hexadeca-1(16),5,7,11-tetraene (PubChem CID 155238505) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is (5Z,7Z)-8-butyl-12-methyl-3,11-diazabicyclo[11.3.0]hexadeca-1(16),5,7,11-tetraene.
| Compound Name | (5Z,7Z)-8-butyl-12-methyl-3,11-diazabicyclo[11.3.0]hexadeca-1(16),5,7,11-tetraene |
|---|---|
| PubChem CID | 155238505 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | (5Z,7Z)-8-butyl-12-methyl-3,11-diazabicyclo[11.3.0]hexadeca-1(16),5,7,11-tetraene |
| SMILES | CCCC/C1=C/C=C\CNCC2=CCCC2/C(C)=N/CC1 |
| InChI | InChI=1S/C19H30N2/c1-3-4-8-17-9-5-6-13-20-15-18-10-7-11-19(18)16(2)21-14-12-17/h5-6,9-10,19-20H,3-4,7-8,11-15H2,1-2H3/b6-5-,17-9-,21-16+ |
| InChIKey | VVXCDMVLMLTCEI-QRMGZPQESA-N |
| XLogP | 4.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|