About N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine
N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine (PubChem CID 155238535) has the molecular formula C10H19NS
and a molecular weight of 185.34 g/mol. Its IUPAC name is N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine.
Molecular Properties
| Compound Name | N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine |
| PubChem CID | 155238535 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine |
| SMILES | C=C/C=C\CCC(C)[C@H](C)NS |
| InChI | InChI=1S/C10H19NS/c1-4-5-6-7-8-9(2)10(3)11-12/h4-6,9-12H,1,7-8H2,2-3H3/b6-5-/t9?,10-/m0/s1 |
| InChIKey | PSAQLJAUJNRFDL-QSYMTYJESA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine?
The IUPAC name of N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine (CID 155238535) is N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine.
What is the SMILES notation for N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine?
The canonical SMILES for N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine is C=C/C=C\CCC(C)[C@H](C)NS.
What is the InChIKey of N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine?
The InChIKey is PSAQLJAUJNRFDL-QSYMTYJESA-N. The full InChI is InChI=1S/C10H19NS/c1-4-5-6-7-8-9(2)10(3)11-12/h4-6,9-12H,1,7-8H2,2-3H3/b6-5-/t9?,10-/m0/s1.
What are the key properties of N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine?
N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine has a molecular weight of 185.34 g/mol, XLogP of 2.97, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,6Z)-3-methylnona-6,8-dien-2-yl]thiohydroxylamine is sourced from PubChem (CID 155238535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).