About 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane
3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane (PubChem CID 155238986) has the molecular formula C12H22ClF3
and a molecular weight of 258.75 g/mol. Its IUPAC name is 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane.
Molecular Properties
| Compound Name | 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane |
| PubChem CID | 155238986 |
| Molecular Formula | C12H22ClF3 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane |
| SMILES | CCC(C(F)(F)F)C(C)(C)CC(Cl)C(C)C |
| InChI | InChI=1S/C12H22ClF3/c1-6-10(12(14,15)16)11(4,5)7-9(13)8(2)3/h8-10H,6-7H2,1-5H3 |
| InChIKey | VVOAGTVDRYJLPZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane?
The IUPAC name of 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane (CID 155238986) is 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane.
What is the SMILES notation for 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane?
The canonical SMILES for 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane is CCC(C(F)(F)F)C(C)(C)CC(Cl)C(C)C.
What is the InChIKey of 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane?
The InChIKey is VVOAGTVDRYJLPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22ClF3/c1-6-10(12(14,15)16)11(4,5)7-9(13)8(2)3/h8-10H,6-7H2,1-5H3.
What are the key properties of 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane?
3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane has a molecular weight of 258.75 g/mol, XLogP of 5.25, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,5,5-trimethyl-6-(trifluoromethyl)octane is sourced from PubChem (CID 155238986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).