C31H42N8S3 — CID 155239287
2-[11-(1H-imidazol-5-yl)-2,4,5,8,11-pentamethyl-8-(1,3-thiazol-4-yl)-5-(1,3-thiazol-5-yl)-2-(1H-1,2,4-triazol-5-yl)dodecan-4-yl]-1,3-thiazole (PubChem CID 155239287) has the molecular formula C31H42N8S3 and a molecular weight of 622.93 g/mol. Its IUPAC name is 2-[11-(1H-imidazol-5-yl)-2,4,5,8,11-pentamethyl-8-(1,3-thiazol-4-yl)-5-(1,3-thiazol-5-yl)-2-(1H-1,2,4-triazol-5-yl)dodecan-4-yl]-1,3-thiazole.
| Compound Name | 2-[11-(1H-imidazol-5-yl)-2,4,5,8,11-pentamethyl-8-(1,3-thiazol-4-yl)-5-(1,3-thiazol-5-yl)-2-(1H-1,2,4-triazol-5-yl)dodecan-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 155239287 |
| Molecular Formula | C31H42N8S3 |
| Molecular Weight | 622.93 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | 2-[11-(1H-imidazol-5-yl)-2,4,5,8,11-pentamethyl-8-(1,3-thiazol-4-yl)-5-(1,3-thiazol-5-yl)-2-(1H-1,2,4-triazol-5-yl)dodecan-4-yl]-1,3-thiazole |
| SMILES | CC(C)(CCC(C)(CCC(C)(c1cncs1)C(C)(CC(C)(C)c1ncn[nH]1)c1nccs1)c1cscn1)c1cnc[nH]1 |
| InChI | InChI=1S/C31H42N8S3/c1-27(2,22-14-32-18-35-22)8-9-29(5,23-16-40-21-37-23)10-11-30(6,24-15-33-20-42-24)31(7,26-34-12-13-41-26)17-28(3,4)25-36-19-38-39-25/h12-16,18-21H,8-11,17H2,1-7H3,(H,32,35)(H,36,38,39) |
| InChIKey | HORRIEZOBAIXNF-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.93 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |