C30H27ClF3N5O3 — CID 155239306
(2S)-N-[(2S,4E,6Z)-4-chloro-1-[(3,3-difluorocyclobutyl)amino]-3-methylidene-1-oxoocta-4,6-dien-2-yl]-1-(4-cyano-2-pyridinyl)-N-(3-fluorophenyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 155239306) has the molecular formula C30H27ClF3N5O3 and a molecular weight of 598.03 g/mol. Its IUPAC name is (2S)-N-[(2S,4E,6Z)-4-chloro-1-[(3,3-difluorocyclobutyl)amino]-3-methylidene-1-oxoocta-4,6-dien-2-yl]-1-(4-cyano-2-pyridinyl)-N-(3-fluorophenyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S,4E,6Z)-4-chloro-1-[(3,3-difluorocyclobutyl)amino]-3-methylidene-1-oxoocta-4,6-dien-2-yl]-1-(4-cyano-2-pyridinyl)-N-(3-fluorophenyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155239306 |
| Molecular Formula | C30H27ClF3N5O3 |
| Molecular Weight | 598.03 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | (2S)-N-[(2S,4E,6Z)-4-chloro-1-[(3,3-difluorocyclobutyl)amino]-3-methylidene-1-oxoocta-4,6-dien-2-yl]-1-(4-cyano-2-pyridinyl)-N-(3-fluorophenyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | C=C(/C(Cl)=C\C=C/C)[C@@H](C(=O)NC1CC(F)(F)C1)N(C(=O)[C@@H]1CCC(=O)N1c1cc(C#N)ccn1)c1cccc(F)c1 |
| InChI | InChI=1S/C30H27ClF3N5O3/c1-3-4-8-23(31)18(2)27(28(41)37-21-15-30(33,34)16-21)38(22-7-5-6-20(32)14-22)29(42)24-9-10-26(40)39(24)25-13-19(17-35)11-12-36-25/h3-8,11-14,21,24,27H,2,9-10,15-16H2,1H3,(H,37,41)/b4-3-,23-8+/t24-,27-/m0/s1 |
| InChIKey | VRLGGAQTGXHDER-LJJWWHSKSA-N |
| XLogP | 5.16 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.03 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|