C13H19N — CID 155239533
N-[(2E,4Z)-hepta-2,4-dien-3-yl]cyclohexa-1,5-dien-1-amine (PubChem CID 155239533) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4-dien-3-yl]cyclohexa-1,5-dien-1-amine.
| Compound Name | N-[(2E,4Z)-hepta-2,4-dien-3-yl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 155239533 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4-dien-3-yl]cyclohexa-1,5-dien-1-amine |
| SMILES | C/C=C(\C=C/CC)NC1=CCCC=C1 |
| InChI | InChI=1S/C13H19N/c1-3-5-9-12(4-2)14-13-10-7-6-8-11-13/h4-5,7,9-11,14H,3,6,8H2,1-2H3/b9-5-,12-4+ |
| InChIKey | DGRYXMSFLVNHHB-WQPWRAGBSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|