C24H31N3O2 — CID 155239718
(2E,4Z)-5-[2-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-methyl-3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]hepta-2,4,6-trienenitrile (PubChem CID 155239718) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is (2E,4Z)-5-[2-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-methyl-3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]hepta-2,4,6-trienenitrile.
| Compound Name | (2E,4Z)-5-[2-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-methyl-3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]hepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 155239718 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | (2E,4Z)-5-[2-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-methyl-3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]hepta-2,4,6-trienenitrile |
| SMILES | C=C/C=C\C=C\N1CC2(CCN(CC/C(C=C)=C/C=C/C#N)CC2)OC(C)C1=O |
| InChI | InChI=1S/C24H31N3O2/c1-4-6-7-10-16-27-20-24(29-21(3)23(27)28)13-18-26(19-14-24)17-12-22(5-2)11-8-9-15-25/h4-11,16,21H,1-2,12-14,17-20H2,3H3/b7-6-,9-8+,16-10+,22-11+ |
| InChIKey | PUDKZFADEBGZSC-PYRXOKMKSA-N |
| XLogP | 3.91 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|