About 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine
7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine (PubChem CID 155239768) has the molecular formula C19H39N
and a molecular weight of 281.53 g/mol. Its IUPAC name is 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine.
Molecular Properties
| Compound Name | 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine |
| PubChem CID | 155239768 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine |
| SMILES | C=C(C)NC(CC(C(C)CC)C(C)(C)C)C(C)CCC |
| InChI | InChI=1S/C19H39N/c1-10-12-16(6)18(20-14(3)4)13-17(15(5)11-2)19(7,8)9/h15-18,20H,3,10-13H2,1-2,4-9H3 |
| InChIKey | PKPFNHDZTFNRTQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine?
The IUPAC name of 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine (CID 155239768) is 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine.
What is the SMILES notation for 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine?
The canonical SMILES for 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine is C=C(C)NC(CC(C(C)CC)C(C)(C)C)C(C)CCC.
What is the InChIKey of 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine?
The InChIKey is PKPFNHDZTFNRTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39N/c1-10-12-16(6)18(20-14(3)4)13-17(15(5)11-2)19(7,8)9/h15-18,20H,3,10-13H2,1-2,4-9H3.
What are the key properties of 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine?
7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine has a molecular weight of 281.53 g/mol, XLogP of 6.01, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-4,8-dimethyl-N-prop-1-en-2-yldecan-5-amine is sourced from PubChem (CID 155239768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).