About N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide
N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide (PubChem CID 155241258) has the molecular formula C13H21N5O2
and a molecular weight of 279.34 g/mol. Its IUPAC name is N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide.
Molecular Properties
| Compound Name | N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide |
| PubChem CID | 155241258 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide |
| SMILES | CN(C)N(C)N(C)N(C)NC(=O)c1ccccc1C=O |
| InChI | InChI=1S/C13H21N5O2/c1-15(2)17(4)18(5)16(3)14-13(20)12-9-7-6-8-11(12)10-19/h6-10H,1-5H3,(H,14,20) |
| InChIKey | HSECDYGYPCJKJG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide?
The IUPAC name of N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide (CID 155241258) is N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide.
What is the SMILES notation for N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide?
The canonical SMILES for N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide is CN(C)N(C)N(C)N(C)NC(=O)c1ccccc1C=O.
What is the InChIKey of N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide?
The InChIKey is HSECDYGYPCJKJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5O2/c1-15(2)17(4)18(5)16(3)14-13(20)12-9-7-6-8-11(12)10-19/h6-10H,1-5H3,(H,14,20).
What are the key properties of N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide?
N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide has a molecular weight of 279.34 g/mol, XLogP of 0.25, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[dimethylamino(methyl)amino]-methylamino]-2-formyl-N'-methylbenzohydrazide is sourced from PubChem (CID 155241258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).