C18H10F4N2O — CID 155241355
2,5-bis[(E)-2-(3,4-difluorophenyl)ethenyl]-1,3,4-oxadiazole (PubChem CID 155241355) has the molecular formula C18H10F4N2O and a molecular weight of 346.28 g/mol. Its IUPAC name is 2,5-bis[(E)-2-(3,4-difluorophenyl)ethenyl]-1,3,4-oxadiazole.
| Compound Name | 2,5-bis[(E)-2-(3,4-difluorophenyl)ethenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 155241355 |
| Molecular Formula | C18H10F4N2O |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2,5-bis[(E)-2-(3,4-difluorophenyl)ethenyl]-1,3,4-oxadiazole |
| SMILES | Fc1ccc(/C=C/c2nnc(/C=C/c3ccc(F)c(F)c3)o2)cc1F |
| InChI | InChI=1S/C18H10F4N2O/c19-13-5-1-11(9-15(13)21)3-7-17-23-24-18(25-17)8-4-12-2-6-14(20)16(22)10-12/h1-10H/b7-3+,8-4+ |
| InChIKey | WUQRWFGLEQIWBN-FCXRPNKRSA-N |
| XLogP | 4.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |