C27H32N6O — CID 15524151
N-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 15524151) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 15524151 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | N-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | c1ccc(C(OC2CCN(CCCCNc3ccc4nncn4n3)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H32N6O/c1-3-9-22(10-4-1)27(23-11-5-2-6-12-23)34-24-15-19-32(20-16-24)18-8-7-17-28-25-13-14-26-30-29-21-33(26)31-25/h1-6,9-14,21,24,27H,7-8,15-20H2,(H,28,31) |
| InChIKey | VPJWDMCKSJWQSU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|