C26H28F3N5O3 — CID 155242132
3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-[[(2S)-4-methylmorpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 155242132) has the molecular formula C26H28F3N5O3 and a molecular weight of 515.54 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-[[(2S)-4-methylmorpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-[[(2S)-4-methylmorpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 155242132 |
| Molecular Formula | C26H28F3N5O3 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-[[(2S)-4-methylmorpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | CN1CCO[C@H](COc2cnccc2-c2[nH]c3c(c2Nc2cccc(F)c2CC(F)F)C(=O)NCC3)C1 |
| InChI | InChI=1S/C26H28F3N5O3/c1-34-9-10-36-15(13-34)14-37-21-12-30-7-5-16(21)24-25(23-20(33-24)6-8-31-26(23)35)32-19-4-2-3-18(27)17(19)11-22(28)29/h2-5,7,12,15,22,32-33H,6,8-11,13-14H2,1H3,(H,31,35)/t15-/m0/s1 |
| InChIKey | RQKGBBNGUNEQLA-HNNXBMFYSA-N |
| XLogP | 3.76 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |